C17H10N4O7 — CID 3406143
3,5-bis(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3406143) has the molecular formula C17H10N4O7 and a molecular weight of 382.29 g/mol. Its IUPAC name is 3,5-bis(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3,5-bis(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3406143 |
| Molecular Formula | C17H10N4O7 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3,5-bis(3-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON=C(c3cccc([N+](=O)[O-])c3)C2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H10N4O7/c22-16-13-14(9-3-1-5-11(7-9)20(24)25)18-28-15(13)17(23)19(16)10-4-2-6-12(8-10)21(26)27/h1-8,13,15H |
| InChIKey | VWWLKROYCVMWQW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|