C19H13N3O7 — CID 98222455
[4-[(3aS,6aS)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]phenyl] acetate (PubChem CID 98222455) has the molecular formula C19H13N3O7 and a molecular weight of 395.33 g/mol. Its IUPAC name is [4-[(3aS,6aS)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]phenyl] acetate.
| Compound Name | [4-[(3aS,6aS)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]phenyl] acetate |
|---|---|
| PubChem CID | 98222455 |
| Molecular Formula | C19H13N3O7 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [4-[(3aS,6aS)-3-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@H]3C(c4cccc([N+](=O)[O-])c4)=NO[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C19H13N3O7/c1-10(23)28-14-7-5-12(6-8-14)21-18(24)15-16(20-29-17(15)19(21)25)11-3-2-4-13(9-11)22(26)27/h2-9,15,17H,1H3/t15-,17-/m0/s1 |
| InChIKey | MFUYJJOIVFQJKJ-RDJZCZTQSA-N |
| XLogP | 1.81 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|