C23H17N3O7 — CID 98452572
(1R,2S,6R,7S,8R,12S)-10-(4-acetylphenyl)-5-(3-nitrophenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 98452572) has the molecular formula C23H17N3O7 and a molecular weight of 447.40 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R,12S)-10-(4-acetylphenyl)-5-(3-nitrophenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1R,2S,6R,7S,8R,12S)-10-(4-acetylphenyl)-5-(3-nitrophenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 98452572 |
| Molecular Formula | C23H17N3O7 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (1R,2S,6R,7S,8R,12S)-10-(4-acetylphenyl)-5-(3-nitrophenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@@H]3[C@H]4O[C@@H]([C@H]5C(c6cccc([N+](=O)[O-])c6)=NO[C@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O7/c1-10(27)11-5-7-13(8-6-11)25-22(28)15-16(23(25)29)20-21-17(19(15)32-20)18(24-33-21)12-3-2-4-14(9-12)26(30)31/h2-9,15-17,19-21H,1H3/t15-,16+,17-,19-,20-,21+/m1/s1 |
| InChIKey | KSSREHMCEWBTJU-RONQAZRQSA-N |
| XLogP | 2.10 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|