C25H21N3O7 — CID 98072961
ethyl 4-[(1S,2R,6S,7R,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate (PubChem CID 98072961) has the molecular formula C25H21N3O7 and a molecular weight of 475.46 g/mol. Its IUPAC name is ethyl 4-[(1S,2R,6S,7R,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate.
| Compound Name | ethyl 4-[(1S,2R,6S,7R,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
|---|---|
| PubChem CID | 98072961 |
| Molecular Formula | C25H21N3O7 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | ethyl 4-[(1S,2R,6S,7R,8R,12S)-5-(3-nitrophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@H]([C@H]5ON=C(c6cccc([N+](=O)[O-])c6)[C@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H21N3O7/c1-2-34-25(31)12-6-8-14(9-7-12)27-23(29)18-16-11-17(19(18)24(27)30)22-20(16)21(26-35-22)13-4-3-5-15(10-13)28(32)33/h3-10,16-20,22H,2,11H2,1H3/t16-,17-,18+,19-,20-,22+/m0/s1 |
| InChIKey | OHAAUMHTNZXCHI-RAZXTWSVSA-N |
| XLogP | 2.95 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|