C27H23N3O6 — CID 51666104
ethyl 4-[(1S,2R,6S,7S,8R,12S)-5-[4-(cyanomethoxy)phenyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate (PubChem CID 51666104) has the molecular formula C27H23N3O6 and a molecular weight of 485.50 g/mol. Its IUPAC name is ethyl 4-[(1S,2R,6S,7S,8R,12S)-5-[4-(cyanomethoxy)phenyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate.
| Compound Name | ethyl 4-[(1S,2R,6S,7S,8R,12S)-5-[4-(cyanomethoxy)phenyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
|---|---|
| PubChem CID | 51666104 |
| Molecular Formula | C27H23N3O6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | ethyl 4-[(1S,2R,6S,7S,8R,12S)-5-[4-(cyanomethoxy)phenyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@H]([C@H]5ON=C(c6ccc(OCC#N)cc6)[C@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H23N3O6/c1-2-34-27(33)15-3-7-16(8-4-15)30-25(31)20-18-13-19(21(20)26(30)32)24-22(18)23(29-36-24)14-5-9-17(10-6-14)35-12-11-28/h3-10,18-22,24H,2,12-13H2,1H3/t18-,19+,20-,21+,22+,24-/m1/s1 |
| InChIKey | CYYRCAGFNPTTNN-PHVPAECOSA-N |
| XLogP | 2.94 |
| TPSA | 118.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|