C27H26N2O7 — CID 124771331
ethyl 4-[(1R,2S,6R,7S,8R,12R)-5-(2,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate (PubChem CID 124771331) has the molecular formula C27H26N2O7 and a molecular weight of 490.51 g/mol. Its IUPAC name is ethyl 4-[(1R,2S,6R,7S,8R,12R)-5-(2,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate.
| Compound Name | ethyl 4-[(1R,2S,6R,7S,8R,12R)-5-(2,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
|---|---|
| PubChem CID | 124771331 |
| Molecular Formula | C27H26N2O7 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | ethyl 4-[(1R,2S,6R,7S,8R,12R)-5-(2,4-dimethoxyphenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]5ON=C(c6ccc(OC)cc6OC)[C@@H]45)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O7/c1-4-35-27(32)13-5-7-14(8-6-13)29-25(30)20-17-12-18(21(20)26(29)31)24-22(17)23(28-36-24)16-10-9-15(33-2)11-19(16)34-3/h5-11,17-18,20-22,24H,4,12H2,1-3H3/t17-,18-,20-,21-,22-,24+/m1/s1 |
| InChIKey | MARLQCIXXTVJFL-JJKZNBGVSA-N |
| XLogP | 3.06 |
| TPSA | 103.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|