C22H15ClFN3O5 — CID 124780067
(1R,2S,6R,7S,8S,12R)-10-(3-chloro-4-fluorophenyl)-5-(3-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 124780067) has the molecular formula C22H15ClFN3O5 and a molecular weight of 455.83 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S,12R)-10-(3-chloro-4-fluorophenyl)-5-(3-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1R,2S,6R,7S,8S,12R)-10-(3-chloro-4-fluorophenyl)-5-(3-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 124780067 |
| Molecular Formula | C22H15ClFN3O5 |
| Molecular Weight | 455.83 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (1R,2S,6R,7S,8S,12R)-10-(3-chloro-4-fluorophenyl)-5-(3-nitrophenyl)-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]4C(c5cccc([N+](=O)[O-])c5)=NO[C@@H]34)[C@@H]2C(=O)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H15ClFN3O5/c23-14-7-10(4-5-15(14)24)26-21(28)16-12-8-13(17(16)22(26)29)20-18(12)19(25-32-20)9-2-1-3-11(6-9)27(30)31/h1-7,12-13,16-18,20H,8H2/t12-,13-,16+,17-,18-,20+/m1/s1 |
| InChIKey | XEGAXJKTILVQBK-HZMRVYKZSA-N |
| XLogP | 3.56 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|