C26H18Cl2N2O3 — CID 124786565
(1R,2S,6R,7S,8R,12R)-5-(2,4-dichlorophenyl)-10-naphthalen-2-yl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 124786565) has the molecular formula C26H18Cl2N2O3 and a molecular weight of 477.35 g/mol. Its IUPAC name is (1R,2S,6R,7S,8R,12R)-5-(2,4-dichlorophenyl)-10-naphthalen-2-yl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1R,2S,6R,7S,8R,12R)-5-(2,4-dichlorophenyl)-10-naphthalen-2-yl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 124786565 |
| Molecular Formula | C26H18Cl2N2O3 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | (1R,2S,6R,7S,8R,12R)-5-(2,4-dichlorophenyl)-10-naphthalen-2-yl-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]4ON=C(c5ccc(Cl)cc5Cl)[C@@H]34)[C@H]2C(=O)N1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H18Cl2N2O3/c27-14-6-8-16(19(28)10-14)23-22-17-11-18(24(22)33-29-23)21-20(17)25(31)30(26(21)32)15-7-5-12-3-1-2-4-13(12)9-15/h1-10,17-18,20-22,24H,11H2/t17-,18-,20-,21-,22-,24+/m1/s1 |
| InChIKey | UKVDKEJGRSWNGK-JJKZNBGVSA-N |
| XLogP | 5.32 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|