C27H20ClN3O3 — CID 177441154
(1S,2S,6S,7S,8R,12S)-5-(4-chlorophenyl)-10-[(E)-naphthalen-2-ylmethylideneamino]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 177441154) has the molecular formula C27H20ClN3O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is (1S,2S,6S,7S,8R,12S)-5-(4-chlorophenyl)-10-[(E)-naphthalen-2-ylmethylideneamino]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2S,6S,7S,8R,12S)-5-(4-chlorophenyl)-10-[(E)-naphthalen-2-ylmethylideneamino]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 177441154 |
| Molecular Formula | C27H20ClN3O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (1S,2S,6S,7S,8R,12S)-5-(4-chlorophenyl)-10-[(E)-naphthalen-2-ylmethylideneamino]-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@H]([C@@H]4ON=C(c5ccc(Cl)cc5)[C@H]34)[C@@H]2C(=O)N1/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H20ClN3O3/c28-18-9-7-16(8-10-18)24-23-19-12-20(25(23)34-30-24)22-21(19)26(32)31(27(22)33)29-13-14-5-6-15-3-1-2-4-17(15)11-14/h1-11,13,19-23,25H,12H2/b29-13+/t19-,20+,21-,22+,23+,25+/m1/s1 |
| InChIKey | ZFNFMMDZGPWNHY-LATXAQHPSA-N |
| XLogP | 4.50 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|