C24H21N3O9 — CID 102469281
(1S,2R,6R,7S,8R,12S)-10-(4-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 102469281) has the molecular formula C24H21N3O9 and a molecular weight of 495.44 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,12S)-10-(4-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2R,6R,7S,8R,12S)-10-(4-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 102469281 |
| Molecular Formula | C24H21N3O9 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | (1S,2R,6R,7S,8R,12S)-10-(4-nitrophenyl)-5-(3,4,5-trimethoxyphenyl)-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | COc1cc(C2=NO[C@H]3[C@H]4O[C@@H]([C@@H]23)[C@@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]42)cc(OC)c1OC |
| InChI | InChI=1S/C24H21N3O9/c1-32-13-8-10(9-14(33-2)19(13)34-3)18-17-20-15-16(21(35-20)22(17)36-25-18)24(29)26(23(15)28)11-4-6-12(7-5-11)27(30)31/h4-9,15-17,20-22H,1-3H3/t15-,16+,17-,20-,21+,22-/m1/s1 |
| InChIKey | QDYYCGNIDBSWOM-AZNOEYCNSA-N |
| XLogP | 1.93 |
| TPSA | 139.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|