C22H18N2O5S — CID 24745527
(1S,2R,6R,7S,8R,12S)-5-(4-methylsulfinylphenyl)-10-phenyl-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione (PubChem CID 24745527) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R,12S)-5-(4-methylsulfinylphenyl)-10-phenyl-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione.
| Compound Name | (1S,2R,6R,7S,8R,12S)-5-(4-methylsulfinylphenyl)-10-phenyl-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
|---|---|
| PubChem CID | 24745527 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (1S,2R,6R,7S,8R,12S)-5-(4-methylsulfinylphenyl)-10-phenyl-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-9,11-dione |
| SMILES | CS(=O)c1ccc(C2=NO[C@H]3[C@H]4O[C@@H]([C@@H]23)[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@H]42)cc1 |
| InChI | InChI=1S/C22H18N2O5S/c1-30(27)13-9-7-11(8-10-13)17-16-18-14-15(19(28-18)20(16)29-23-17)22(26)24(21(14)25)12-5-3-2-4-6-12/h2-10,14-16,18-20H,1H3/t14-,15+,16-,18-,19+,20-,30?/m1/s1 |
| InChIKey | LQPGTTLZAGIVES-SZTOERBPSA-N |
| XLogP | 1.73 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|