C22H17N2Na2O9P — CID 46840288
disodium;[4-[5-(4-methoxyphenyl)-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]phenyl] phosphate (PubChem CID 46840288) has the molecular formula C22H17N2Na2O9P and a molecular weight of 530.34 g/mol. Its IUPAC name is disodium;[4-[5-(4-methoxyphenyl)-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]phenyl] phosphate.
| Compound Name | disodium;[4-[5-(4-methoxyphenyl)-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 46840288 |
| Molecular Formula | C22H17N2Na2O9P |
| Molecular Weight | 530.34 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | disodium;[4-[5-(4-methoxyphenyl)-9,11-dioxo-3,13-dioxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]phenyl] phosphate |
| SMILES | COc1ccc(C2=NOC3C4OC(C23)C2C(=O)N(c3ccc(OP(=O)([O-])[O-])cc3)C(=O)C42)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H19N2O9P.2Na/c1-30-12-6-2-10(3-7-12)17-16-18-14-15(19(31-18)20(16)32-23-17)22(26)24(21(14)25)11-4-8-13(9-5-11)33-34(27,28)29;;/h2-9,14-16,18-20H,1H3,(H2,27,28,29);;/q;2*+1/p-2 |
| InChIKey | SNCSXACYODEWBP-UHFFFAOYSA-L |
| XLogP | -5.78 |
| TPSA | 149.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.34 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|