C19H13N3O6 — CID 98225300
(3aS,6aS)-5-(4-acetylphenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98225300) has the molecular formula C19H13N3O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is (3aS,6aS)-5-(4-acetylphenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aS)-5-(4-acetylphenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98225300 |
| Molecular Formula | C19H13N3O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (3aS,6aS)-5-(4-acetylphenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)[C@H]3C(c4ccc([N+](=O)[O-])cc4)=NO[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C19H13N3O6/c1-10(23)11-2-6-13(7-3-11)21-18(24)15-16(20-28-17(15)19(21)25)12-4-8-14(9-5-12)22(26)27/h2-9,15,17H,1H3/t15-,17-/m0/s1 |
| InChIKey | VZGFPANIASJQBY-RDJZCZTQSA-N |
| XLogP | 2.09 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|