C18H10N4O8 — CID 27884294
(3aS,6aS)-3-(4-nitrobenzoyl)-5-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 27884294) has the molecular formula C18H10N4O8 and a molecular weight of 410.30 g/mol. Its IUPAC name is (3aS,6aS)-3-(4-nitrobenzoyl)-5-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aS,6aS)-3-(4-nitrobenzoyl)-5-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 27884294 |
| Molecular Formula | C18H10N4O8 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (3aS,6aS)-3-(4-nitrobenzoyl)-5-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C(C1=NO[C@@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H10N4O8/c23-15(9-1-3-11(4-2-9)21(26)27)14-13-16(30-19-14)18(25)20(17(13)24)10-5-7-12(8-6-10)22(28)29/h1-8,13,16H/t13-,16-/m0/s1 |
| InChIKey | OHFWWHNIWSUOME-BBRMVZONSA-N |
| XLogP | 1.63 |
| TPSA | 162.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|