C20H16N2O5 — CID 2753837
5-(4-methoxyphenyl)-3-(4-methylbenzoyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 2753837) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-(4-methylbenzoyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(4-methoxyphenyl)-3-(4-methylbenzoyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 2753837 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-(4-methylbenzoyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1ccc(N2C(=O)C3ON=C(C(=O)c4ccc(C)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C20H16N2O5/c1-11-3-5-12(6-4-11)17(23)16-15-18(27-21-16)20(25)22(19(15)24)13-7-9-14(26-2)10-8-13/h3-10,15,18H,1-2H3 |
| InChIKey | UPKLGNZIGILXLA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|