C27H24N4O7 — CID 7173221
ethyl 4-[(3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carbonyl]-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxylate (PubChem CID 7173221) has the molecular formula C27H24N4O7 and a molecular weight of 516.51 g/mol. Its IUPAC name is ethyl 4-[(3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carbonyl]-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carbonyl]-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7173221 |
| Molecular Formula | C27H24N4O7 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | ethyl 4-[(3aS,6aR)-5-(4-methoxyphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-3-carbonyl]-5-methyl-1-(4-methylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c(C)c1C(=O)C1=NO[C@H]2C(=O)N(c3ccc(OC)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C27H24N4O7/c1-5-37-27(35)22-19(15(3)31(28-22)17-8-6-14(2)7-9-17)23(32)21-20-24(38-29-21)26(34)30(25(20)33)16-10-12-18(36-4)13-11-16/h6-13,20,24H,5H2,1-4H3/t20-,24+/m0/s1 |
| InChIKey | FVVAQUCXNHYOMY-GBXCKJPGSA-N |
| XLogP | 2.80 |
| TPSA | 129.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|