C17H10FN3O5 — CID 7214936
(3aR,6aR)-5-(3-fluorophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 7214936) has the molecular formula C17H10FN3O5 and a molecular weight of 355.28 g/mol. Its IUPAC name is (3aR,6aR)-5-(3-fluorophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3aR,6aR)-5-(3-fluorophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 7214936 |
| Molecular Formula | C17H10FN3O5 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (3aR,6aR)-5-(3-fluorophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1[C@@H]2C(c3ccc([N+](=O)[O-])cc3)=NO[C@H]2C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C17H10FN3O5/c18-10-2-1-3-12(8-10)20-16(22)13-14(19-26-15(13)17(20)23)9-4-6-11(7-5-9)21(24)25/h1-8,13,15H/t13-,15-/m1/s1 |
| InChIKey | GTTIINNVRULUMN-UKRRQHHQSA-N |
| XLogP | 2.03 |
| TPSA | 102.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|