C26H29NO — CID 45276682
1-[(R)-[(2S)-2-but-3-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol (PubChem CID 45276682) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is 1-[(R)-[(2S)-2-but-3-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol.
| Compound Name | 1-[(R)-[(2S)-2-but-3-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 45276682 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[(R)-[(2S)-2-but-3-enylpiperidin-1-yl]-phenylmethyl]naphthalen-2-ol |
| SMILES | C=CCC[C@@H]1CCCCN1[C@H](c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C26H29NO/c1-2-3-14-22-15-9-10-19-27(22)26(21-12-5-4-6-13-21)25-23-16-8-7-11-20(23)17-18-24(25)28/h2,4-8,11-13,16-18,22,26,28H,1,3,9-10,14-15,19H2/t22-,26-/m1/s1 |
| InChIKey | HDTOTIWUVXDEST-ATIYNZHBSA-N |
| XLogP | 6.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|