C24H28N2O — CID 45378573
1-[[4-(dimethylamino)phenyl]-piperidin-1-ylmethyl]naphthalen-2-ol (PubChem CID 45378573) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]-piperidin-1-ylmethyl]naphthalen-2-ol.
| Compound Name | 1-[[4-(dimethylamino)phenyl]-piperidin-1-ylmethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 45378573 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]-piperidin-1-ylmethyl]naphthalen-2-ol |
| SMILES | CN(C)c1ccc(C(c2c(O)ccc3ccccc23)N2CCCCC2)cc1 |
| InChI | InChI=1S/C24H28N2O/c1-25(2)20-13-10-19(11-14-20)24(26-16-6-3-7-17-26)23-21-9-5-4-8-18(21)12-15-22(23)27/h4-5,8-15,24,27H,3,6-7,16-17H2,1-2H3 |
| InChIKey | YWYSXDGGJDLHST-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|