C21H21NO — CID 141365807
2-[(R)-phenyl(pyrrolidin-1-yl)methyl]naphthalen-1-ol (PubChem CID 141365807) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is 2-[(R)-phenyl(pyrrolidin-1-yl)methyl]naphthalen-1-ol.
| Compound Name | 2-[(R)-phenyl(pyrrolidin-1-yl)methyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 141365807 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[(R)-phenyl(pyrrolidin-1-yl)methyl]naphthalen-1-ol |
| SMILES | Oc1c([C@@H](c2ccccc2)N2CCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C21H21NO/c23-21-18-11-5-4-8-16(18)12-13-19(21)20(22-14-6-7-15-22)17-9-2-1-3-10-17/h1-5,8-13,20,23H,6-7,14-15H2/t20-/m1/s1 |
| InChIKey | QTHBCDAKDPGRMA-HXUWFJFHSA-N |
| XLogP | 4.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|