C19H23NO — CID 3843964
4-methyl-2-[phenyl(piperidin-1-yl)methyl]phenol (PubChem CID 3843964) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-methyl-2-[phenyl(piperidin-1-yl)methyl]phenol.
| Compound Name | 4-methyl-2-[phenyl(piperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 3843964 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 4-methyl-2-[phenyl(piperidin-1-yl)methyl]phenol |
| SMILES | Cc1ccc(O)c(C(c2ccccc2)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H23NO/c1-15-10-11-18(21)17(14-15)19(16-8-4-2-5-9-16)20-12-6-3-7-13-20/h2,4-5,8-11,14,19,21H,3,6-7,12-13H2,1H3 |
| InChIKey | MNVILXTYVPVWLJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|