About 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol
1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol (PubChem CID 53242721) has the molecular formula C26H27NO
and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol |
| PubChem CID | 53242721 |
| Molecular Formula | C26H27NO |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol |
| SMILES | C=CC[C@@H]1CC[C@H](C=C)N1[C@@H](c1ccccc1)c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C26H27NO/c1-3-10-22-17-16-21(4-2)27(22)26(20-12-6-5-7-13-20)25-23-14-9-8-11-19(23)15-18-24(25)28/h3-9,11-15,18,21-22,26,28H,1-2,10,16-17H2/t21-,22+,26-/m0/s1 |
| InChIKey | UJRVUMAUBDQYHT-VRUMLPLGSA-N |
| XLogP | 6.23 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol?
The IUPAC name of 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol (CID 53242721) is 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol.
What is the SMILES notation for 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol?
The canonical SMILES for 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol is C=CC[C@@H]1CC[C@H](C=C)N1[C@@H](c1ccccc1)c1c(O)ccc2ccccc12.
What is the InChIKey of 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol?
The InChIKey is UJRVUMAUBDQYHT-VRUMLPLGSA-N. The full InChI is InChI=1S/C26H27NO/c1-3-10-22-17-16-21(4-2)27(22)26(20-12-6-5-7-13-20)25-23-14-9-8-11-19(23)15-18-24(25)28/h3-9,11-15,18,21-22,26,28H,1-2,10,16-17H2/t21-,22+,26-/m0/s1.
What are the key properties of 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol?
1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol has a molecular weight of 369.51 g/mol, XLogP of 6.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(S)-[(2R,5S)-2-ethenyl-5-prop-2-enylpyrrolidin-1-yl]-phenylmethyl]naphthalen-2-ol is sourced from PubChem (CID 53242721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).