C16H17N — CID 164888024
2-ethenyl-1-naphthalen-1-ylpyrrolidine (PubChem CID 164888024) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-ethenyl-1-naphthalen-1-ylpyrrolidine.
| Compound Name | 2-ethenyl-1-naphthalen-1-ylpyrrolidine |
|---|---|
| PubChem CID | 164888024 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-ethenyl-1-naphthalen-1-ylpyrrolidine |
| SMILES | C=CC1CCCN1c1cccc2ccccc12 |
| InChI | InChI=1S/C16H17N/c1-2-14-9-6-12-17(14)16-11-5-8-13-7-3-4-10-15(13)16/h2-5,7-8,10-11,14H,1,6,9,12H2 |
| InChIKey | DBQFOPOKVNLKER-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|