C15H14F3N — CID 86337138
(2S)-1-naphthalen-1-yl-2-(trifluoromethyl)pyrrolidine (PubChem CID 86337138) has the molecular formula C15H14F3N and a molecular weight of 265.28 g/mol. Its IUPAC name is (2S)-1-naphthalen-1-yl-2-(trifluoromethyl)pyrrolidine.
| Compound Name | (2S)-1-naphthalen-1-yl-2-(trifluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 86337138 |
| Molecular Formula | C15H14F3N |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2S)-1-naphthalen-1-yl-2-(trifluoromethyl)pyrrolidine |
| SMILES | FC(F)(F)[C@@H]1CCCN1c1cccc2ccccc12 |
| InChI | InChI=1S/C15H14F3N/c16-15(17,18)14-9-4-10-19(14)13-8-3-6-11-5-1-2-7-12(11)13/h1-3,5-8,14H,4,9-10H2/t14-/m0/s1 |
| InChIKey | XQXYPQQCTHOHGW-AWEZNQCLSA-N |
| XLogP | 4.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |