C15H15NO3 — CID 67245808
(2S)-3-hydroxy-1-naphthalen-1-ylpyrrolidine-2-carboxylic acid (PubChem CID 67245808) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (2S)-3-hydroxy-1-naphthalen-1-ylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-3-hydroxy-1-naphthalen-1-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67245808 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2S)-3-hydroxy-1-naphthalen-1-ylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C(O)CCN1c1cccc2ccccc12 |
| InChI | InChI=1S/C15H15NO3/c17-13-8-9-16(14(13)15(18)19)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-14,17H,8-9H2,(H,18,19)/t13?,14-/m0/s1 |
| InChIKey | IFIOBTPREWOQBS-KZUDCZAMSA-N |
| XLogP | 1.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |