C14H15N3 — CID 167966111
8-(2-ethenylpyrrolidin-1-yl)-1,7-naphthyridine (PubChem CID 167966111) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 8-(2-ethenylpyrrolidin-1-yl)-1,7-naphthyridine.
| Compound Name | 8-(2-ethenylpyrrolidin-1-yl)-1,7-naphthyridine |
|---|---|
| PubChem CID | 167966111 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 8-(2-ethenylpyrrolidin-1-yl)-1,7-naphthyridine |
| SMILES | C=CC1CCCN1c1nccc2cccnc12 |
| InChI | InChI=1S/C14H15N3/c1-2-12-6-4-10-17(12)14-13-11(7-9-16-14)5-3-8-15-13/h2-3,5,7-9,12H,1,4,6,10H2 |
| InChIKey | FQMCONJVGNESDY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|