C17H16O2 — CID 70690575
2-methylidene-1-propan-2-yl-1H-benzo[f]chromen-3-one (PubChem CID 70690575) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-methylidene-1-propan-2-yl-1H-benzo[f]chromen-3-one.
| Compound Name | 2-methylidene-1-propan-2-yl-1H-benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 70690575 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-methylidene-1-propan-2-yl-1H-benzo[f]chromen-3-one |
| SMILES | C=C1C(=O)Oc2ccc3ccccc3c2C1C(C)C |
| InChI | InChI=1S/C17H16O2/c1-10(2)15-11(3)17(18)19-14-9-8-12-6-4-5-7-13(12)16(14)15/h4-10,15H,3H2,1-2H3 |
| InChIKey | FJIVOWIQAHKNEE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|