C27H15BrO3 — CID 122205322
13-(4-bromophenyl)-2-oxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaene-10,11-dione (PubChem CID 122205322) has the molecular formula C27H15BrO3 and a molecular weight of 467.32 g/mol. Its IUPAC name is 13-(4-bromophenyl)-2-oxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaene-10,11-dione.
| Compound Name | 13-(4-bromophenyl)-2-oxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaene-10,11-dione |
|---|---|
| PubChem CID | 122205322 |
| Molecular Formula | C27H15BrO3 |
| Molecular Weight | 467.32 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 13-(4-bromophenyl)-2-oxapentacyclo[12.8.0.03,12.04,9.015,20]docosa-1(14),3(12),4,6,8,15,17,19,21-nonaene-10,11-dione |
| SMILES | O=C1C(=O)c2ccccc2C2=C1C(c1ccc(Br)cc1)c1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C27H15BrO3/c28-17-12-9-16(10-13-17)22-23-18-6-2-1-5-15(18)11-14-21(23)31-27-20-8-4-3-7-19(20)25(29)26(30)24(22)27/h1-14,22H |
| InChIKey | TUEBSDLPBCJZHG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.32 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|