C22H13BrO4 — CID 122374845
2-(3-bromophenyl)-6-methyl-5,9-dioxatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione (PubChem CID 122374845) has the molecular formula C22H13BrO4 and a molecular weight of 421.25 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6-methyl-5,9-dioxatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione.
| Compound Name | 2-(3-bromophenyl)-6-methyl-5,9-dioxatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
|---|---|
| PubChem CID | 122374845 |
| Molecular Formula | C22H13BrO4 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 2-(3-bromophenyl)-6-methyl-5,9-dioxatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),6,11,13,15-hexaene-4,17-dione |
| SMILES | Cc1cc2c(c(=O)o1)C(c1cccc(Br)c1)C1=C(O2)c2ccccc2C1=O |
| InChI | InChI=1S/C22H13BrO4/c1-11-9-16-18(22(25)26-11)17(12-5-4-6-13(23)10-12)19-20(24)14-7-2-3-8-15(14)21(19)27-16/h2-10,17H,1H3 |
| InChIKey | SZAFGGQMJVOEPN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |