C35H23BrN2O3 — CID 162417200
12-(3-bromophenyl)-3-methyl-2,5-diphenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione (PubChem CID 162417200) has the molecular formula C35H23BrN2O3 and a molecular weight of 599.48 g/mol. Its IUPAC name is 12-(3-bromophenyl)-3-methyl-2,5-diphenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione.
| Compound Name | 12-(3-bromophenyl)-3-methyl-2,5-diphenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
|---|---|
| PubChem CID | 162417200 |
| Molecular Formula | C35H23BrN2O3 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 12-(3-bromophenyl)-3-methyl-2,5-diphenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
| SMILES | Cc1cc2c(c(=O)n1-c1ccccc1)C(c1cccc(Br)c1)C1=C(C(=O)c3ccccc3C1=O)N2c1ccccc1 |
| InChI | InChI=1S/C35H23BrN2O3/c1-21-19-28-30(35(41)37(21)24-13-4-2-5-14-24)29(22-11-10-12-23(36)20-22)31-32(38(28)25-15-6-3-7-16-25)34(40)27-18-9-8-17-26(27)33(31)39/h2-20,29H,1H3 |
| InChIKey | NBPQBFVYLCBNPI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|