C37H28N2O3 — CID 162417207
3-methyl-2,5-bis(4-methylphenyl)-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione (PubChem CID 162417207) has the molecular formula C37H28N2O3 and a molecular weight of 548.64 g/mol. Its IUPAC name is 3-methyl-2,5-bis(4-methylphenyl)-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione.
| Compound Name | 3-methyl-2,5-bis(4-methylphenyl)-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
|---|---|
| PubChem CID | 162417207 |
| Molecular Formula | C37H28N2O3 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 3-methyl-2,5-bis(4-methylphenyl)-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
| SMILES | Cc1ccc(N2C3=C(C(=O)c4ccccc4C3=O)C(c3ccccc3)c3c2cc(C)n(-c2ccc(C)cc2)c3=O)cc1 |
| InChI | InChI=1S/C37H28N2O3/c1-22-13-17-26(18-14-22)38-24(3)21-30-32(37(38)42)31(25-9-5-4-6-10-25)33-34(39(30)27-19-15-23(2)16-20-27)36(41)29-12-8-7-11-28(29)35(33)40/h4-21,31H,1-3H3 |
| InChIKey | VXPVWFRYVOJJMN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|