C35H22Cl2N2O3 — CID 162417212
2,5-bis(3-chlorophenyl)-3-methyl-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione (PubChem CID 162417212) has the molecular formula C35H22Cl2N2O3 and a molecular weight of 589.48 g/mol. Its IUPAC name is 2,5-bis(3-chlorophenyl)-3-methyl-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione.
| Compound Name | 2,5-bis(3-chlorophenyl)-3-methyl-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
|---|---|
| PubChem CID | 162417212 |
| Molecular Formula | C35H22Cl2N2O3 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | 2,5-bis(3-chlorophenyl)-3-methyl-12-phenyl-12H-naphtho[3,2-b][1,6]naphthyridine-1,6,11-trione |
| SMILES | Cc1cc2c(c(=O)n1-c1cccc(Cl)c1)C(c1ccccc1)C1=C(C(=O)c3ccccc3C1=O)N2c1cccc(Cl)c1 |
| InChI | InChI=1S/C35H22Cl2N2O3/c1-20-17-28-30(35(42)38(20)24-13-7-11-22(36)18-24)29(21-9-3-2-4-10-21)31-32(39(28)25-14-8-12-23(37)19-25)34(41)27-16-6-5-15-26(27)33(31)40/h2-19,29H,1H3 |
| InChIKey | FMLQNYLDAAXTML-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|