C29H23ClN2O2 — CID 2456646
(4E)-2-(3-chlorophenyl)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]isoquinoline-1,3-dione (PubChem CID 2456646) has the molecular formula C29H23ClN2O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is (4E)-2-(3-chlorophenyl)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]isoquinoline-1,3-dione.
| Compound Name | (4E)-2-(3-chlorophenyl)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2456646 |
| Molecular Formula | C29H23ClN2O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | (4E)-2-(3-chlorophenyl)-4-[[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]methylidene]isoquinoline-1,3-dione |
| SMILES | Cc1cccc(-n2c(C)cc(/C=C3/C(=O)N(c4cccc(Cl)c4)C(=O)c4ccccc43)c2C)c1 |
| InChI | InChI=1S/C29H23ClN2O2/c1-18-8-6-10-23(14-18)31-19(2)15-21(20(31)3)16-27-25-12-4-5-13-26(25)28(33)32(29(27)34)24-11-7-9-22(30)17-24/h4-17H,1-3H3/b27-16+ |
| InChIKey | AHMADGXYOVZACG-JVWAILMASA-N |
| XLogP | 6.78 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|