C23H16INO2 — CID 2570121
(4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione (PubChem CID 2570121) has the molecular formula C23H16INO2 and a molecular weight of 465.29 g/mol. Its IUPAC name is (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2570121 |
| Molecular Formula | C23H16INO2 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | (4Z)-4-[(2-iodophenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione |
| SMILES | Cc1cccc(N2C(=O)/C(=C\c3ccccc3I)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H16INO2/c1-15-7-6-9-17(13-15)25-22(26)19-11-4-3-10-18(19)20(23(25)27)14-16-8-2-5-12-21(16)24/h2-14H,1H3/b20-14- |
| InChIKey | OYOKAFPVIDKBGW-ZHZULCJRSA-N |
| XLogP | 5.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|