C24H18BrNO4 — CID 3364104
4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione (PubChem CID 3364104) has the molecular formula C24H18BrNO4 and a molecular weight of 464.32 g/mol. Its IUPAC name is 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 3364104 |
| Molecular Formula | C24H18BrNO4 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-2-(3-methylphenyl)isoquinoline-1,3-dione |
| SMILES | COc1cc(C=C2C(=O)N(c3cccc(C)c3)C(=O)c3ccccc32)cc(Br)c1O |
| InChI | InChI=1S/C24H18BrNO4/c1-14-6-5-7-16(10-14)26-23(28)18-9-4-3-8-17(18)19(24(26)29)11-15-12-20(25)22(27)21(13-15)30-2/h3-13,27H,1-2H3 |
| InChIKey | ZVYRCHHCMYGOJC-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|