C25H16Br2N2O2 — CID 132563166
3,4-bis(3-bromophenyl)-1-methyl-4H-benzo[h]cinnoline-5,6-dione (PubChem CID 132563166) has the molecular formula C25H16Br2N2O2 and a molecular weight of 536.22 g/mol. Its IUPAC name is 3,4-bis(3-bromophenyl)-1-methyl-4H-benzo[h]cinnoline-5,6-dione.
| Compound Name | 3,4-bis(3-bromophenyl)-1-methyl-4H-benzo[h]cinnoline-5,6-dione |
|---|---|
| PubChem CID | 132563166 |
| Molecular Formula | C25H16Br2N2O2 |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 533.96 |
| IUPAC Name | 3,4-bis(3-bromophenyl)-1-methyl-4H-benzo[h]cinnoline-5,6-dione |
| SMILES | CN1N=C(c2cccc(Br)c2)C(c2cccc(Br)c2)C2=C1c1ccccc1C(=O)C2=O |
| InChI | InChI=1S/C25H16Br2N2O2/c1-29-23-18-10-2-3-11-19(18)24(30)25(31)21(23)20(14-6-4-8-16(26)12-14)22(28-29)15-7-5-9-17(27)13-15/h2-13,20H,1H3 |
| InChIKey | YDDMZJOAWDOBBW-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|