C20H13BrN2O — CID 3554989
4-(3-bromophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 3554989) has the molecular formula C20H13BrN2O and a molecular weight of 377.24 g/mol. Its IUPAC name is 4-(3-bromophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | 4-(3-bromophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3554989 |
| Molecular Formula | C20H13BrN2O |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 4-(3-bromophenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(c2cccc(Br)c2)C2=C(N1)c1ccccc1C2=O |
| InChI | InChI=1S/C20H13BrN2O/c1-11-16(10-22)17(12-5-4-6-13(21)9-12)18-19(23-11)14-7-2-3-8-15(14)20(18)24/h2-9,17,23H,1H3 |
| InChIKey | VOGKFBWYUAVSCC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|