C22H18BrNO4 — CID 2890786
methyl 4-(3-bromo-4-methoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 2890786) has the molecular formula C22H18BrNO4 and a molecular weight of 440.29 g/mol. Its IUPAC name is methyl 4-(3-bromo-4-methoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | methyl 4-(3-bromo-4-methoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2890786 |
| Molecular Formula | C22H18BrNO4 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | methyl 4-(3-bromo-4-methoxyphenyl)-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C22H18BrNO4/c1-11-17(22(26)28-3)18(12-8-9-16(27-2)15(23)10-12)19-20(24-11)13-6-4-5-7-14(13)21(19)25/h4-10,18,24H,1-3H3 |
| InChIKey | APEWJGONSPQPJC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|