C28H21BrN2O6 — CID 98074883
methyl (4S)-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate (PubChem CID 98074883) has the molecular formula C28H21BrN2O6 and a molecular weight of 561.39 g/mol. Its IUPAC name is methyl (4S)-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate.
| Compound Name | methyl (4S)-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 98074883 |
| Molecular Formula | C28H21BrN2O6 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | methyl (4S)-4-[3-bromo-4-[(4-nitrophenyl)methoxy]phenyl]-2-methyl-5-oxo-1,4-dihydroindeno[1,2-b]pyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)[C@@H]1c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C28H21BrN2O6/c1-15-23(28(33)36-2)24(25-26(30-15)19-5-3-4-6-20(19)27(25)32)17-9-12-22(21(29)13-17)37-14-16-7-10-18(11-8-16)31(34)35/h3-13,24,30H,14H2,1-2H3/t24-/m1/s1 |
| InChIKey | IIOZDKKEHXOSQN-XMMPIXPASA-N |
| XLogP | 5.68 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|