C23H20N2O — CID 946895
(4S)-2-methyl-5-oxo-4-(4-propan-2-ylphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile (PubChem CID 946895) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is (4S)-2-methyl-5-oxo-4-(4-propan-2-ylphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile.
| Compound Name | (4S)-2-methyl-5-oxo-4-(4-propan-2-ylphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 946895 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (4S)-2-methyl-5-oxo-4-(4-propan-2-ylphenyl)-1,4-dihydroindeno[1,2-b]pyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)[C@H](c2ccc(C(C)C)cc2)C2=C(N1)c1ccccc1C2=O |
| InChI | InChI=1S/C23H20N2O/c1-13(2)15-8-10-16(11-9-15)20-19(12-24)14(3)25-22-17-6-4-5-7-18(17)23(26)21(20)22/h4-11,13,20,25H,1-3H3/t20-/m0/s1 |
| InChIKey | VMJIBEQBRRMOKJ-FQEVSTJZSA-N |
| XLogP | 4.90 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|