C19H15NO2 — CID 132933509
3-methyl-2-phenyl-6H-isochromeno[4,3-c]pyridin-1-one (PubChem CID 132933509) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-methyl-2-phenyl-6H-isochromeno[4,3-c]pyridin-1-one.
| Compound Name | 3-methyl-2-phenyl-6H-isochromeno[4,3-c]pyridin-1-one |
|---|---|
| PubChem CID | 132933509 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-methyl-2-phenyl-6H-isochromeno[4,3-c]pyridin-1-one |
| SMILES | Cc1cc2c(c(=O)n1-c1ccccc1)-c1ccccc1CO2 |
| InChI | InChI=1S/C19H15NO2/c1-13-11-17-18(16-10-6-5-7-14(16)12-22-17)19(21)20(13)15-8-3-2-4-9-15/h2-11H,12H2,1H3 |
| InChIKey | AGVNOQHKBGFXCU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |