C22H17NO2 — CID 71748732
1-methyl-9-phenyl-6,10-dihydrochromeno[4,3-f]isoindol-8-one (PubChem CID 71748732) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-methyl-9-phenyl-6,10-dihydrochromeno[4,3-f]isoindol-8-one.
| Compound Name | 1-methyl-9-phenyl-6,10-dihydrochromeno[4,3-f]isoindol-8-one |
|---|---|
| PubChem CID | 71748732 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-methyl-9-phenyl-6,10-dihydrochromeno[4,3-f]isoindol-8-one |
| SMILES | Cc1cccc2c1-c1cc3c(cc1CO2)C(=O)N(c1ccccc1)C3 |
| InChI | InChI=1S/C22H17NO2/c1-14-6-5-9-20-21(14)18-10-15-12-23(17-7-3-2-4-8-17)22(24)19(15)11-16(18)13-25-20/h2-11H,12-13H2,1H3 |
| InChIKey | LAIZKWFNMHCXFM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |