C27H18O5 — CID 164576357
20-hydroxy-18-methyl-12-(4-methylphenyl)-2,15-dioxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14(19),17,20-octaene-10,16-dione (PubChem CID 164576357) has the molecular formula C27H18O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 20-hydroxy-18-methyl-12-(4-methylphenyl)-2,15-dioxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14(19),17,20-octaene-10,16-dione.
| Compound Name | 20-hydroxy-18-methyl-12-(4-methylphenyl)-2,15-dioxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14(19),17,20-octaene-10,16-dione |
|---|---|
| PubChem CID | 164576357 |
| Molecular Formula | C27H18O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 20-hydroxy-18-methyl-12-(4-methylphenyl)-2,15-dioxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4,6,8,14(19),17,20-octaene-10,16-dione |
| SMILES | Cc1ccc(C2C3=C(Oc4cc(O)c5c(C)cc(=O)oc5c42)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C27H18O5/c1-13-7-9-15(10-8-13)22-23-19(12-18(28)21-14(2)11-20(29)32-27(21)23)31-26-17-6-4-3-5-16(17)25(30)24(22)26/h3-12,22,28H,1-2H3 |
| InChIKey | SJRMJGDMRMKAKJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|