C21H15BrO3 — CID 102034723
methyl (1S)-1-(4-bromophenyl)-1H-benzo[f]chromene-3-carboxylate (PubChem CID 102034723) has the molecular formula C21H15BrO3 and a molecular weight of 395.25 g/mol. Its IUPAC name is methyl (1S)-1-(4-bromophenyl)-1H-benzo[f]chromene-3-carboxylate.
| Compound Name | methyl (1S)-1-(4-bromophenyl)-1H-benzo[f]chromene-3-carboxylate |
|---|---|
| PubChem CID | 102034723 |
| Molecular Formula | C21H15BrO3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | methyl (1S)-1-(4-bromophenyl)-1H-benzo[f]chromene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccc(Br)cc2)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C21H15BrO3/c1-24-21(23)19-12-17(14-6-9-15(22)10-7-14)20-16-5-3-2-4-13(16)8-11-18(20)25-19/h2-12,17H,1H3/t17-/m0/s1 |
| InChIKey | JYQMZYCRZLYGHK-KRWDZBQOSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |