C15H14O — CID 132583813
1-ethyl-2-methylidene-1H-benzo[e][1]benzofuran (PubChem CID 132583813) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-ethyl-2-methylidene-1H-benzo[e][1]benzofuran.
| Compound Name | 1-ethyl-2-methylidene-1H-benzo[e][1]benzofuran |
|---|---|
| PubChem CID | 132583813 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-ethyl-2-methylidene-1H-benzo[e][1]benzofuran |
| SMILES | C=C1Oc2ccc3ccccc3c2C1CC |
| InChI | InChI=1S/C15H14O/c1-3-12-10(2)16-14-9-8-11-6-4-5-7-13(11)15(12)14/h4-9,12H,2-3H2,1H3 |
| InChIKey | AEUPHAOOUQCSGG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |