C29H31N2OP — CID 177388305
(1R)-N,N-diethyl-1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3,2]benzoxazaphosphinin-3-amine (PubChem CID 177388305) has the molecular formula C29H31N2OP and a molecular weight of 454.55 g/mol. Its IUPAC name is (1R)-N,N-diethyl-1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3,2]benzoxazaphosphinin-3-amine.
| Compound Name | (1R)-N,N-diethyl-1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3,2]benzoxazaphosphinin-3-amine |
|---|---|
| PubChem CID | 177388305 |
| Molecular Formula | C29H31N2OP |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | (1R)-N,N-diethyl-1-phenyl-2-[(1R)-1-phenylethyl]-1H-benzo[f][1,3,2]benzoxazaphosphinin-3-amine |
| SMILES | CCN(CC)P1Oc2ccc3ccccc3c2[C@@H](c2ccccc2)N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C29H31N2OP/c1-4-30(5-2)33-31(22(3)23-14-8-6-9-15-23)29(25-17-10-7-11-18-25)28-26-19-13-12-16-24(26)20-21-27(28)32-33/h6-22,29H,4-5H2,1-3H3/t22-,29-,33?/m1/s1 |
| InChIKey | XSNNVMNADUHNDW-FCDRTNJSSA-N |
| XLogP | 7.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|