C17H21NO4 — CID 10859641
ethyl 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-3-oxobutanoate (PubChem CID 10859641) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 10859641 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | ethyl 2-(2-acetyl-3,4-dihydro-1H-isoquinolin-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)C(C(C)=O)C1c2ccccc2CCN1C(C)=O |
| InChI | InChI=1S/C17H21NO4/c1-4-22-17(21)15(11(2)19)16-14-8-6-5-7-13(14)9-10-18(16)12(3)20/h5-8,15-16H,4,9-10H2,1-3H3 |
| InChIKey | UARPCMMWSASLDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|