C19H30N2O — CID 175901516
1-nonan-3-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 175901516) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-nonan-3-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | 1-nonan-3-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 175901516 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-nonan-3-yl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CCCCCCC(CC)C1c2ccccc2CCN1C(N)=O |
| InChI | InChI=1S/C19H30N2O/c1-3-5-6-7-10-15(4-2)18-17-12-9-8-11-16(17)13-14-21(18)19(20)22/h8-9,11-12,15,18H,3-7,10,13-14H2,1-2H3,(H2,20,22) |
| InChIKey | LIBONWRJDGSGDC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|