C18H27NO2 — CID 70518138
1-(1-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)octan-1-one (PubChem CID 70518138) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(1-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)octan-1-one.
| Compound Name | 1-(1-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)octan-1-one |
|---|---|
| PubChem CID | 70518138 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-(1-methoxy-3,4-dihydro-1H-isoquinolin-2-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCc2ccccc2C1OC |
| InChI | InChI=1S/C18H27NO2/c1-3-4-5-6-7-12-17(20)19-14-13-15-10-8-9-11-16(15)18(19)21-2/h8-11,18H,3-7,12-14H2,1-2H3 |
| InChIKey | VIHDRVDSOCDVFD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|