C30H41N3O4 — CID 68711069
N-[4-nitro-2,6-di(propan-2-yl)phenyl]-2-octanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 68711069) has the molecular formula C30H41N3O4 and a molecular weight of 507.68 g/mol. Its IUPAC name is N-[4-nitro-2,6-di(propan-2-yl)phenyl]-2-octanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | N-[4-nitro-2,6-di(propan-2-yl)phenyl]-2-octanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 68711069 |
| Molecular Formula | C30H41N3O4 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | N-[4-nitro-2,6-di(propan-2-yl)phenyl]-2-octanoyl-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCCCCCCC(=O)N1CCc2ccccc2C1C(=O)Nc1c(C(C)C)cc([N+](=O)[O-])cc1C(C)C |
| InChI | InChI=1S/C30H41N3O4/c1-6-7-8-9-10-15-27(34)32-17-16-22-13-11-12-14-24(22)29(32)30(35)31-28-25(20(2)3)18-23(33(36)37)19-26(28)21(4)5/h11-14,18-21,29H,6-10,15-17H2,1-5H3,(H,31,35) |
| InChIKey | NRYSNFKJOIPZAD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|